Index of /school-detail

[ICO]NameLast modifiedSizeDescription

[PARENTDIR]Parent Directory   -  
[   ] 2019-09-28 16:26 224  
[   ]schoolDetail.js 2019-09-29 17:54 26K 
[TXT]source.html 2019-12-26 02:47 8.2K 
[TXT]school-detail-mainBo..>2020-01-12 18:12 22K 
[TXT]html_file_names.txt 2020-01-19 17:26 154K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Vani..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nirman-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-Carmel-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Max-Mull..>2020-01-19 17:26 8.2K 
[TXT]school-info-Swarna-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-Orchids-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Arundath..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nandini-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ryan-Int..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ekya-Sch..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vagdevi-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Whitefie..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pragathi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sharada-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Forest-T..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-BGS-Nati..>2020-01-19 17:26 8.2K 
[TXT]school-info-Innisfre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Inlingua..>2020-01-19 17:26 8.2K 
[TXT]school-info-Freedom-..>2020-01-19 17:26 8.2K 
[TXT]school-info-National..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Brig..>2020-01-19 17:26 8.2K 
[TXT]school-info-National..>2020-01-19 17:26 8.2K 
[TXT]school-info-Loyola-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-Delhi-Pu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Manageme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Treamis-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Acts-Sec..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ebenezer..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sunrise-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Toddler'..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-National..>2020-01-19 17:26 8.2K 
[TXT]school-info-Greenwoo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gnan-Sri..>2020-01-19 17:26 8.2K 
[TXT]school-info-BRS-Glob..>2020-01-19 17:26 8.2K 
[TXT]school-info-XLNC-Dan..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kara4Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Amaa..>2020-01-19 17:26 8.2K 
[TXT]school-info-VIBGYOR-..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Cath..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vijaya-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-J-S-S-Ed..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Nati..>2020-01-19 17:26 8.2K 
[TXT]school-info-Loyola-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Adarsh-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ekya-Sch..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-F..>2020-01-19 17:26 8.2K 
[TXT]school-info-Christ-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chinmaya..>2020-01-19 17:26 8.2K 
[TXT]school-info-Magic-Pu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Lawrence..>2020-01-19 17:26 8.2K 
[TXT]school-info-Baldwin-..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Germ..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Rock`..>2020-01-19 17:26 8.2K 
[TXT]school-info-National..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bangalor..>2020-01-19 17:26 8.2K 
[TXT]school-info-Associat..>2020-01-19 17:26 8.2K 
[TXT]school-info-Indian-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-Baldwin-..>2020-01-19 17:26 8.2K 
[TXT]school-info-ST-JOSEP..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cluny-Co..>2020-01-19 17:26 8.2K 
[TXT]school-info-Canadian..>2020-01-19 17:26 8.2K 
[TXT]school-info-Seshadri..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vidyashi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Air-Forc..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bhavya-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vyasa-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-B-G-Nati..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mahimapp..>2020-01-19 17:26 8.2K 
[TXT]school-info-Triveni-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Stephen-..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-KM-Engli..>2020-01-19 17:26 8.2K 
[TXT]school-info-Blossoms..>2020-01-19 17:26 8.2K 
[TXT]school-info-JMM-Publ..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-PODAR-JU..>2020-01-19 17:26 8.2K 
[TXT]school-info-Widia-Po..>2020-01-19 17:26 8.2K 
[TXT]school-info-School-o..>2020-01-19 17:26 8.2K 
[TXT]school-info-Anantha-..>2020-01-19 17:26 8.2K 
[TXT]school-info-G-Lps-Na..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-G-HPS-An..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-G-Lps-Ya..>2020-01-19 17:26 8.2K 
[TXT]school-info-Govt-Low..>2020-01-19 17:26 8.2K 
[TXT]school-info-GEAR-Inn..>2020-01-19 17:26 8.2K 
[TXT]school-info-MVJ-Inte..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Deen..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nigli's-..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Brig..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kendriya..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cluny-Co..>2020-01-19 17:26 8.2K 
[TXT]school-info-CMR-Inst..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jain-Her..>2020-01-19 17:26 8.2K 
[TXT]school-info-Trio-Wor..>2020-01-19 17:26 8.2K 
[TXT]school-info-Brindava..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vidya-Ni..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Kuma..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Vall..>2020-01-19 17:26 8.2K 
[TXT]school-info-DAV-Publ..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jnana-Sw..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gurukul-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jyothy-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Rashtrot..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-JESUS'-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ananthna..>2020-01-19 17:26 8.2K 
[TXT]school-info-Edify-Sc..>2020-01-19 17:26 8.2K 
[TXT]school-info-AECS-Mag..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sarala-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Venkat-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-VSS-Inte..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kendriya..>2020-01-19 17:26 8.2K 
[TXT]school-info-PODAR-JU..>2020-01-19 17:26 8.2K 
[TXT]school-info-Poorna-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jawahar-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Seshadri..>2020-01-19 17:26 8.2K 
[TXT]school-info-Govt-sch..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ohio-Man..>2020-01-19 17:26 8.2K 
[TXT]school-info-M-E-C-Pr..>2020-01-19 17:26 8.2K 
[TXT]school-info-Higher-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Inventur..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Inte..>2020-01-19 17:26 8.2K 
[TXT]school-info-Silver-O..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bangalor..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sandeepa..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Sara..>2020-01-19 17:26 8.2K 
[TXT]school-info-Govt-Hig..>2020-01-19 17:26 8.2K 
[TXT]school-info-Govt-Low..>2020-01-19 17:26 8.2K 
[TXT]school-info-Govt-Kan..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kalari-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-United-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sukrupa-..>2020-01-19 17:26 8.2K 
[TXT]school-info-PSBB-Lea..>2020-01-19 17:26 8.2K 
[TXT]school-info-Redbridg..>2020-01-19 17:26 8.2K 
[TXT]school-info-Alpha-Pu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Asian-Ch..>2020-01-19 17:26 8.2K 
[TXT]school-info-Don-Bosc..>2020-01-19 17:26 8.2K 
[TXT]school-info-Swami-Vi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Poorna-L..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bhavan-N..>2020-01-19 17:26 8.2K 
[TXT]school-info-SRNS-EDU..>2020-01-19 17:26 8.2K 
[TXT]school-info-Xtreme-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jyothi-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Govt--Hi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sneha-Ca..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aurinko-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Saint-Fr..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aditya-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-GITAM-UN..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Deva..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nivedith..>2020-01-19 17:26 8.2K 
[TXT]school-info-GHPS-Gun..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Arav..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-G-Lps-Do..>2020-01-19 17:26 8.2K 
[TXT]school-info-Govt-Hig..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Jose..>2020-01-19 17:26 8.2K 
[TXT]school-info-Maharish..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Josep..>2020-01-19 17:26 8.2K 
[TXT]school-info-Blossoms..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kokino-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-G-Lps-By..>2020-01-19 17:26 8.2K 
[TXT]school-info-Greendot..>2020-01-19 17:26 8.2K 
[TXT]school-info-GOVERNME..>2020-01-19 17:26 8.2K 
[TXT]school-info-Baldwin-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chitrako..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Home..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gnana-Bo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Inner-Mo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vidya-Sa..>2020-01-19 17:26 8.2K 
[TXT]school-info-Janaseva..>2020-01-19 17:26 8.2K 
[TXT]school-info-Excel-Bu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shristi-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Acharya-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Royal-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP---Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Basavana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vishal-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vishal-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-G-Lower-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Royal-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-Veena-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-G-Hps-Is..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ashraya-..>2020-01-19 17:26 8.2K 
[TXT]school-info-VIBGYOR-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Sath..>2020-01-19 17:26 8.2K 
[TXT]school-info-G-Ulps-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-G-Lps-Do..>2020-01-19 17:26 8.2K 
[TXT]school-info-G-Lps-Ya..>2020-01-19 17:26 8.2K 
[TXT]school-info-Higher-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-GISB-Chi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-MBA-Bang..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-National..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Presiden..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shree-Sh..>2020-01-19 17:26 8.2K 
[TXT]school-info-Stonehil..>2020-01-19 17:26 8.2K 
[TXT]school-info-jawahar-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gnanagan..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cambridg..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bhuvan-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-Begur-Go..>2020-01-19 17:26 8.2K 
[TXT]school-info-Dig-Comm..>2020-01-19 17:26 8.2K 
[TXT]school-info-Marry-La..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Maru..>2020-01-19 17:26 8.2K 
[TXT]school-info-National..>2020-01-19 17:26 8.2K 
[TXT]school-info-Center-f..>2020-01-19 17:26 8.2K 
[TXT]school-info-Carmel-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Prarthan..>2020-01-19 17:26 8.2K 
[TXT]school-info-Legacy-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Indus-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-ISME---I..>2020-01-19 17:26 8.2K 
[TXT]school-info-Oakridge..>2020-01-19 17:26 8.2K 
[TXT]school-info-Indus-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gear-Inn..>2020-01-19 17:26 8.2K 
[TXT]school-info-Govt-Urd..>2020-01-19 17:26 8.2K 
[TXT]school-info-Govt-Low..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sabic-Te..>2020-01-19 17:26 8.2K 
[TXT]school-info-G-Ulps-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Federal-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Oasis-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-ISBR-Bus..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sherwood..>2020-01-19 17:26 8.2K 
[TXT]school-info-IFIM-Bus..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ryan-Int..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Stracey-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Achiever..>2020-01-19 17:26 8.2K 
[TXT]school-info-Al-Bashe..>2020-01-19 17:26 8.2K 
[TXT]school-info-Radcliff..>2020-01-19 17:26 8.2K 
[TXT]school-info-B-M-Srin..>2020-01-19 17:26 8.2K 
[TXT]school-info-V-L-S-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-Yashasvi..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Fran..>2020-01-19 17:26 8.2K 
[TXT]school-info-Garden-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Kuma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Asia-Pac..>2020-01-19 17:26 8.2K 
[TXT]school-info-GEAR-Fou..>2020-01-19 17:26 8.2K 
[TXT]school-info-Dayanand..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mirambik..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mitra-Ac..>2020-01-19 17:26 8.2K 
[TXT]school-info-Abacus-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Appollo-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jawahar-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Delhi-Pu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vinayaka..>2020-01-19 17:26 8.2K 
[TXT]school-info-National..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kendriya..>2020-01-19 17:26 8.2K 
[TXT]school-info-Englewoo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Euro-Sch..>2020-01-19 17:26 8.2K 
[TXT]school-info-Oxford-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-G-Lps-Ka..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-GHPS-Byc..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Maruthi-..>2020-01-19 17:26 8.2K 
[TXT]school-info-G-Lps-Th..>2020-01-19 17:26 8.2K 
[TXT]school-info-Roots-Ac..>2020-01-19 17:26 8.2K 
[TXT]school-info-RMS-Inte..>2020-01-19 17:26 8.2K 
[TXT]school-info-JollyKid..>2020-01-19 17:26 8.2K 
[TXT]school-info-STUDIO-V..>2020-01-19 17:26 8.2K 
[TXT]school-info-JET-Scho..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP---An..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Thim..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-ASB-GOVT..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pragathi..>2020-01-19 17:26 8.2K 
[TXT]school-info-AKSHARA-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Muniveer..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sai-City..>2020-01-19 17:26 8.2K 
[TXT]school-info-Oasis-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-Good-Wil..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Silicon-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Lourd-Vi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Happy-Fe..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-BEL-Vidy..>2020-01-19 17:26 8.2K 
[TXT]school-info-Poola-Sc..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vibgyor-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Singanay..>2020-01-19 17:26 8.2K 
[TXT]school-info-Brillian..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vibgyor-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Madhu-Sc..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Your-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sujaya-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-De-Sales..>2020-01-19 17:26 8.2K 
[TXT]school-info-Caterpil..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shambhav..>2020-01-19 17:26 8.2K 
[TXT]school-info-mom-n-mo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Rasika-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Soundary..>2020-01-19 17:26 8.2K 
[TXT]school-info-School-f..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bishop-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gangothr..>2020-01-19 17:26 8.2K 
[TXT]school-info-Veda-Vij..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pavadash..>2020-01-19 17:26 8.2K 
[TXT]school-info-Harsha-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP---Ne..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shri-Sid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kanva-Pu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Yoganara..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Harward-..>2020-01-19 17:26 8.2K 
[TXT]school-info-B-P--Ind..>2020-01-19 17:26 8.2K 
[TXT]school-info-NITTE-IN..>2020-01-19 17:26 8.2K 
[TXT]school-info-NITTE-Sc..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nagarjun..>2020-01-19 17:26 8.2K 
[TXT]school-info-Airforce..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gopalan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-VIVERO-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-Insight-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Indian-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mudugurk..>2020-01-19 17:26 8.2K 
[TXT]school-info-Lower-Pr..>2020-01-19 17:26 8.2K 
[TXT]school-info-G-Lps-Cg..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-G-Lps-Mu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sorsfort..>2020-01-19 17:26 8.2K 
[TXT]school-info-IZee-Bus..>2020-01-19 17:26 8.2K 
[TXT]school-info-KLAY-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-NIBE--(N..>2020-01-19 17:26 8.2K 
[TXT]school-info-Orchids-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Reliable..>2020-01-19 17:26 8.2K 
[TXT]school-info-GVS-Engl..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vidyaram..>2020-01-19 17:26 8.2K 
[TXT]school-info-Music-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Camb..>2020-01-19 17:26 8.2K 
[TXT]school-info-Presiden..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chrysali..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Xavi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bluebell..>2020-01-19 17:26 8.2K 
[TXT]school-info-K-M-ENGL..>2020-01-19 17:26 8.2K 
[TXT]school-info-Soundary..>2020-01-19 17:26 8.2K 
[TXT]school-info-REEDS-DA..>2020-01-19 17:26 8.2K 
[TXT]school-info-National..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ashok-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vijayash..>2020-01-19 17:26 8.2K 
[TXT]school-info-Akash-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mount-Ca..>2020-01-19 17:26 8.2K 
[TXT]school-info-Amrita-V..>2020-01-19 17:26 8.2K 
[TXT]school-info-Academy-..>2020-01-19 17:26 8.2K 
[TXT]school-info-J-Thimma..>2020-01-19 17:26 8.2K 
[TXT]school-info-governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Al-Ameen..>2020-01-19 17:26 8.2K 
[TXT]school-info-Citizen-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vivekana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-GGMS-Hos..>2020-01-19 17:26 8.2K 
[TXT]school-info-Murarji-..>2020-01-19 17:26 8.2K 
[TXT]school-info-G-Hps-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Flow..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jodi-Hus..>2020-01-19 17:26 8.2K 
[TXT]school-info-Xavier-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-Harvest-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Delhi-Pu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Greenwoo..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Patri..>2020-01-19 17:26 8.2K 
[TXT]school-info-Head-Sta..>2020-01-19 17:26 8.2K 
[TXT]school-info-VIBGYOR-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Indus-Bu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Clarence..>2020-01-19 17:26 8.2K 
[TXT]school-info-Notre-Da..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Chet..>2020-01-19 17:26 8.2K 
[TXT]school-info-Primus-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Royal-Co..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Franc..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ramana-V..>2020-01-19 17:26 8.2K 
[TXT]school-info-Swamy-Vi..>2020-01-19 17:26 8.2K 
[TXT]school-info-M-S-V--P..>2020-01-19 17:26 8.2K 
[TXT]school-info-MABL-Hig..>2020-01-19 17:26 8.2K 
[TXT]school-info-Swami-Vi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Devala-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vishwa-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Bald..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gregorio..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee--..>2020-01-19 17:26 8.2K 
[TXT]school-info-BTL-Coll..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-National..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Saandipi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Swargara..>2020-01-19 17:26 8.2K 
[TXT]school-info-National..>2020-01-19 17:26 8.2K 
[TXT]school-info-Srgvvk-T..>2020-01-19 17:26 8.2K 
[TXT]school-info-NIIT--Ka..>2020-01-19 17:26 8.2K 
[TXT]school-info-Moulya-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pearl-Va..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vidhatha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kaveri-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Saraswat..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-G-Lps-Dy..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bengalur..>2020-01-19 17:26 8.2K 
[TXT]school-info-Clarence..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kensri-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Micha..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Bald..>2020-01-19 17:26 8.2K 
[TXT]school-info-CMR-Nati..>2020-01-19 17:26 8.2K 
[TXT]school-info-VIDYANIK..>2020-01-19 17:26 8.2K 
[TXT]school-info-Dr--S--R..>2020-01-19 17:26 8.2K 
[TXT]school-info-SJR-Publ..>2020-01-19 17:26 8.2K 
[TXT]school-info-SSB-Inte..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ravindra..>2020-01-19 17:26 8.2K 
[TXT]school-info-Seventh-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sindhi-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-Abdul-Ba..>2020-01-19 17:26 8.2K 
[TXT]school-info-B-M-Engl..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kendriya..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sindhi-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sophia-O..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kendriya..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nirmala-..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-M-S--Ram..>2020-01-19 17:26 8.2K 
[TXT]school-info-Care-Ind..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kristu-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kendriya..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jubilee-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Presiden..>2020-01-19 17:26 8.2K 
[TXT]school-info-Asha-Int..>2020-01-19 17:26 8.2K 
[TXT]school-info-East-Wes..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bangalor..>2020-01-19 17:26 8.2K 
[TXT]school-info-S--CADAM..>2020-01-19 17:26 8.2K 
[TXT]school-info-Excel-Bu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Vani..>2020-01-19 17:26 8.2K 
[TXT]school-info-BET-Conv..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vidyanik..>2020-01-19 17:26 8.2K 
[TXT]school-info-Al-Ameen..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Vive..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bharath-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-SB-Schoo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Petanaha..>2020-01-19 17:26 8.2K 
[TXT]school-info-GHPS-Kur..>2020-01-19 17:26 8.2K 
[TXT]school-info-G-LPS-Ch..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Auro..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Rege..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bethany-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Brookfie..>2020-01-19 17:26 8.2K 
[TXT]school-info-SVET-Ins..>2020-01-19 17:26 8.2K 
[TXT]school-info-B-T-L--H..>2020-01-19 17:26 8.2K 
[TXT]school-info-Swamy-Vi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Green-Do..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-SFS-Scho..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Phelo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Christ-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Candor-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Samh..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nurture-..>2020-01-19 17:26 8.2K 
[TXT]school-info-ALPINE-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pristine..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Daffodil..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kindle-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Hori..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cambridg..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Bang..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shishya-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Glo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mallya-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cambridg..>2020-01-19 17:26 8.2K 
[TXT]school-info-Diana-Pu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tree-Hou..>2020-01-19 17:26 8.2K 
[TXT]school-info-B-P-Indi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kendriya..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Bang..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Vani..>2020-01-19 17:26 8.2K 
[TXT]school-info-SG-Inter..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jindal-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Sri-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kendriya..>2020-01-19 17:26 8.2K 
[TXT]school-info-S-G-Nati..>2020-01-19 17:26 8.2K 
[TXT]school-info-Royale-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Acharya-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Oriental..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mother-T..>2020-01-19 17:26 8.2K 
[TXT]school-info-R-T-Naga..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Raku..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Inte..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Manjunat..>2020-01-19 17:26 8.2K 
[TXT]school-info-G-LPS-Ba..>2020-01-19 17:26 8.2K 
[TXT]school-info-Neev---K..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Hori..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gopalan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bishop-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bishop-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Army-Pub..>2020-01-19 17:26 8.2K 
[TXT]school-info-Air-Forc..>2020-01-19 17:26 8.2K 
[TXT]school-info-RASHTRIY..>2020-01-19 17:26 8.2K 
[TXT]school-info-Deva-Mat..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jain-Int..>2020-01-19 17:26 8.2K 
[TXT]school-info-AMC-Scho..>2020-01-19 17:26 8.2K 
[TXT]school-info-A-S-C-Pu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Air-Forc..>2020-01-19 17:26 8.2K 
[TXT]school-info-Amara-Jy..>2020-01-19 17:26 8.2K 
[TXT]school-info-ANAND-SH..>2020-01-19 17:26 8.2K 
[TXT]school-info-BBUL-Jai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Geetanja..>2020-01-19 17:26 8.2K 
[TXT]school-info-HAL-Publ..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-T-I-Ce..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Oxfo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bangalor..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vivekana..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Fran..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sacred-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sishu-Gr..>2020-01-19 17:26 8.2K 
[TXT]school-info-National..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Thom..>2020-01-19 17:26 8.2K 
[TXT]school-info-National..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nava-Pra..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Yashoda-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Yashoda-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Yashoda-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Yashoda-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Oi-Play-..>2020-01-19 17:26 8.2K 
[TXT]school-info-DPS-Play..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chrysali..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kindle-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pravesh-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Neuerth-..>2020-01-19 17:26 8.2K 
[TXT]school-info-TimeKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bodhi-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nurture-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tom-&-Je..>2020-01-19 17:26 8.2K 
[TXT]school-info-Globetro..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sarah-Mo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sarah-Mo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sarah-Mo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sarah-Mo..>2020-01-19 17:26 8.2K 
[TXT]school-info-TimeKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-TimeKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-TimeKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-TimeKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-TimeKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-TimeKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-TimeKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-TimeKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-TimeKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-TimeKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-TimeKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-TimeKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-TimeKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-TimeKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-TimeKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-TimeKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-TimeKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tree-Hou..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tree-Hou..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tree-Hou..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tree-Hou..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tree-Hou..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tree-Hou..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tree-Hou..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tree-Hou..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tree-Hou..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tree-Hou..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tree-Hou..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tree-Hou..>2020-01-19 17:26 8.2K 
[TXT]school-info-Prajval-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Let's-Vi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Blossoms..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kid-'S'-..>2020-01-19 17:26 8.2K 
[TXT]school-info-SERRA-IN..>2020-01-19 17:26 8.2K 
[TXT]school-info-LEGACY-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-TEDDIES-..>2020-01-19 17:26 8.2K 
[TXT]school-info-TEDDIES-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-PRISHTI-..>2020-01-19 17:26 8.2K 
[TXT]school-info-KITES-Ku..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kephee-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Arise-'n..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jolly-Go..>2020-01-19 17:26 8.2K 
[TXT]school-info-KLAY-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-SERRA-IN..>2020-01-19 17:26 8.2K 
[TXT]school-info-SERRA-IN..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidz-Pat..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-NURTURE-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Seeds-of..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smartkid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Oi-Play-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smartkid..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-Oi-Play-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Blueberr..>2020-01-19 17:26 8.2K 
[TXT]school-info-EKAAKSHA..>2020-01-19 17:26 8.2K 
[TXT]school-info-SERRA-IN..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mount-Li..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mount-Li..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mount-Li..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bachpan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Euro-Sch..>2020-01-19 17:26 8.2K 
[TXT]school-info-Euro-Sch..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-Y..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-Y..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-W..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-W..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-R..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-V..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-T..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-T..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-R..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-R..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-R..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-W..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-U..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-N..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-D..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-R..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Deens-Ac..>2020-01-19 17:26 8.2K 
[TXT]school-info-Deens-Ac..>2020-01-19 17:26 8.2K 
[TXT]school-info-Foundati..>2020-01-19 17:26 8.2K 
[TXT]school-info-Foundati..>2020-01-19 17:26 8.2K 
[TXT]school-info-Foundati..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-APPLE-KI..>2020-01-19 17:26 8.2K 
[TXT]school-info-APPLE-KI..>2020-01-19 17:26 8.2K 
[TXT]school-info-APPLE-KI..>2020-01-19 17:26 8.2K 
[TXT]school-info-APPLE-KI..>2020-01-19 17:26 8.2K 
[TXT]school-info-APPLE-KI..>2020-01-19 17:26 8.2K 
[TXT]school-info-APPLE-KI..>2020-01-19 17:26 8.2K 
[TXT]school-info-APPLE-KI..>2020-01-19 17:26 8.2K 
[TXT]school-info-APPLE-KI..>2020-01-19 17:26 8.2K 
[TXT]school-info-APPLE-KI..>2020-01-19 17:26 8.2K 
[TXT]school-info-APPLE-KI..>2020-01-19 17:26 8.2K 
[TXT]school-info-APPLE-KI..>2020-01-19 17:26 8.2K 
[TXT]school-info-APPLE-KI..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Helios-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Helios-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Play-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kara4Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kara4Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smartkid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smartkid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smartkid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smartkid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smartkid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smartkid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smartkid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smartkid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smartkid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smartkid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smartkid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smartkid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smartkid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smartkid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smartkid..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Litt..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Litt..>2020-01-19 17:26 8.2K 
[TXT]school-info-WeCare-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-WeCare-W..>2020-01-19 17:26 8.2K 
[TXT]school-info-WeCare--..>2020-01-19 17:26 8.2K 
[TXT]school-info-WeCare--..>2020-01-19 17:26 8.2K 
[TXT]school-info-WeCare--..>2020-01-19 17:26 8.2K 
[TXT]school-info-WeCare--..>2020-01-19 17:26 8.2K 
[TXT]school-info-WeCare--..>2020-01-19 17:26 8.2K 
[TXT]school-info-WeCare-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-WeCare-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-WeCare--..>2020-01-19 17:26 8.2K 
[TXT]school-info-Your-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Your-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Your-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Your-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Your-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Your-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Your-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Your-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Your-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Your-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Your-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Your-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vibgyor-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vibgyor-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vibgyor-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vibgyor-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vibgyor-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aerokids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aerokids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aerokids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aerokids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aerokids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aerokids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aerokids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aerokids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aerokids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aerokids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aerokids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aerokids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Blossoms..>2020-01-19 17:26 8.2K 
[TXT]school-info-Blossoms..>2020-01-19 17:26 8.2K 
[TXT]school-info-Blossoms..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kangaroo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kangaroo..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-MapleBea..>2020-01-19 17:26 8.2K 
[TXT]school-info-Neev-Whi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Neev-Sad..>2020-01-19 17:26 8.2K 
[TXT]school-info-Neev-Kor..>2020-01-19 17:26 8.2K 
[TXT]school-info-Neev-Que..>2020-01-19 17:26 8.2K 
[TXT]school-info-Insight-..>2020-01-19 17:26 8.2K 
[TXT]school-info-DPS-East..>2020-01-19 17:26 8.2K 
[TXT]school-info-DPS-Bang..>2020-01-19 17:26 8.2K 
[TXT]school-info-DPS-Sout..>2020-01-19 17:26 8.2K 
[TXT]school-info-DPS-Elec..>2020-01-19 17:26 8.2K 
[TXT]school-info-DPS-Whit..>2020-01-19 17:26 8.2K 
[TXT]school-info-DPS-Whit..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ayon-Int..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ayon-Int..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Sri-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Sri-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Sri-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Sri-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Sri-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Sri-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Sri-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Sri-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Sri-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Sri-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Dev-In-N..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shiksha-..>2020-01-19 17:26 8.2K 
[TXT]school-info-North-Hi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kingston..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cauvery-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chrysali..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chrysali..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chrysali..>2020-01-19 17:26 8.2K 
[TXT]school-info-Saint-Cl..>2020-01-19 17:26 8.2K 
[TXT]school-info-ANTHONY-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cam..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cam..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cam..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cam..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cam..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cam..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cam..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cam..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cam..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Sapi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pupil-Tr..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Pupi..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Pupi..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Pupi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Peepal-T..>2020-01-19 17:26 8.2K 
[TXT]school-info-Glentree..>2020-01-19 17:26 8.2K 
[TXT]school-info-Greenwoo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Greenwoo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Greenwoo..>2020-01-19 17:26 8.2K 
[TXT]school-info-GREENWOO..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Camb..>2020-01-19 17:26 8.2K 
[TXT]school-info-Orchids-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Orchids-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Orchids-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Royale-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Royale-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Royale-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Royale-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kunskaps..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sharanya..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Brig..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Bald..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Bald..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Bald..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Sai-..>2020-01-19 17:26 8.2K 
[TXT]school-info-VIVERO-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-VIVERO-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-VIVERO-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-VIVERO-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-TOUCH-IN..>2020-01-19 17:26 8.2K 
[TXT]school-info-TOUCH-IN..>2020-01-19 17:26 8.2K 
[TXT]school-info-Swarna-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-Swarna-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ekya-Sch..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ekya-Sch..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vagdevi-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vagdevi-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pratham-..>2020-01-19 17:26 8.2K 
[TXT]school-info-BRS-Glob..>2020-01-19 17:26 8.2K 
[TXT]school-info-DAFFODIL..>2020-01-19 17:26 8.2K 
[TXT]school-info-AUDEN-PU..>2020-01-19 17:26 8.2K 
[TXT]school-info-Charan's..>2020-01-19 17:26 8.2K 
[TXT]school-info-Charan's..>2020-01-19 17:26 8.2K 
[TXT]school-info-Fatima-N..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gitanjal..>2020-01-19 17:26 8.2K 
[TXT]school-info-GOODWILL..>2020-01-19 17:26 8.2K 
[TXT]school-info-HMR-Inte..>2020-01-19 17:26 8.2K 
[TXT]school-info-Malleswa..>2020-01-19 17:26 8.2K 
[TXT]school-info-Dreamers..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-O..>2020-01-19 17:26 8.2K 
[TXT]school-info-Trebles-..>2020-01-19 17:26 8.2K 
[TXT]school-info-little-T..>2020-01-19 17:26 8.2K 
[TXT]school-info-Trebbles..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shanthi-..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Char..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Flor..>2020-01-19 17:26 8.2K 
[TXT]school-info-Infant-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-Florence..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Loua..>2020-01-19 17:26 8.2K 
[TXT]school-info-Fairy-Zo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gems-Nur..>2020-01-19 17:26 8.2K 
[TXT]school-info-Natania-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Johnson-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jay-Play..>2020-01-19 17:26 8.2K 
[TXT]school-info-Santa-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vritti-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Litt..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ekam-Spo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Orange-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-Trained-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Science-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Eye-Leve..>2020-01-19 17:26 8.2K 
[TXT]school-info-Panchvat..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tots-Lan..>2020-01-19 17:26 8.2K 
[TXT]school-info-LITTLE-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bugs-Bun..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Shar..>2020-01-19 17:26 8.2K 
[TXT]school-info-Patel-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Notty-Fe..>2020-01-19 17:26 8.2K 
[TXT]school-info-Manohers..>2020-01-19 17:26 8.2K 
[TXT]school-info-ROOTS-TO..>2020-01-19 17:26 8.2K 
[TXT]school-info-ROOTS-TO..>2020-01-19 17:26 8.2K 
[TXT]school-info-ROOTS-TO..>2020-01-19 17:26 8.2K 
[TXT]school-info-ROOTS-TO..>2020-01-19 17:26 8.2K 
[TXT]school-info-ROOTS-TO..>2020-01-19 17:26 8.2K 
[TXT]school-info-ROOTS-TO..>2020-01-19 17:26 8.2K 
[TXT]school-info-ROOTS-TO..>2020-01-19 17:26 8.2K 
[TXT]school-info-ROOTS-TO..>2020-01-19 17:26 8.2K 
[TXT]school-info-ROOTS-TO..>2020-01-19 17:26 8.2K 
[TXT]school-info-ROOTS-TO..>2020-01-19 17:26 8.2K 
[TXT]school-info-ROOTS-TO..>2020-01-19 17:26 8.2K 
[TXT]school-info-ROOTS-TO..>2020-01-19 17:26 8.2K 
[TXT]school-info-ROOTS-TO..>2020-01-19 17:26 8.2K 
[TXT]school-info-ROOTS-TO..>2020-01-19 17:26 8.2K 
[TXT]school-info-ROOTS-TO..>2020-01-19 17:26 8.2K 
[TXT]school-info-Elizas-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Paul's-N..>2020-01-19 17:26 8.2K 
[TXT]school-info-Christ-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Max-Chil..>2020-01-19 17:26 8.2K 
[TXT]school-info-Blueberr..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gyananja..>2020-01-19 17:26 8.2K 
[TXT]school-info-Rennys-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Lynnsdal..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jolly-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nurture-..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-EuroKids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Miracle-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Elements..>2020-01-19 17:26 8.2K 
[TXT]school-info-Freethin..>2020-01-19 17:26 8.2K 
[TXT]school-info-Time-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Time-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Time-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Time-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Time-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Time-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Time-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Time-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Time-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Time-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Time-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Time-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Time-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Time-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-WeCare-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vibgyor-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vibgyor-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vibgyor-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vibgyor-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aerokids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aerokids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aerokids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aerokids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aerokids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aerokids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Blossoms..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cub..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cub..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cub..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cub..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cub..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cub..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cub..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cub..>2020-01-19 17:26 8.2K 
[TXT]school-info-HeadSmar..>2020-01-19 17:26 8.2K 
[TXT]school-info-Janati-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mithra-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mithra-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sakshara..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ants-Mon..>2020-01-19 17:26 8.2K 
[TXT]school-info-Head-Sta..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-F..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chimes-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Indian-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Indian-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Akshara-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ace-Mont..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ankita-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Anurag-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Anveshan..>2020-01-19 17:26 8.2K 
[TXT]school-info-Arunodoy..>2020-01-19 17:26 8.2K 
[TXT]school-info-Atreya-V..>2020-01-19 17:26 8.2K 
[TXT]school-info-Blues-an..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Child-Ca..>2020-01-19 17:26 8.2K 
[TXT]school-info-Discover..>2020-01-19 17:26 8.2K 
[TXT]school-info-Dishaa-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Divine-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Floretz-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Fleurdal..>2020-01-19 17:26 8.2K 
[TXT]school-info-Growing-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Golden-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Growing-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gyan-Mon..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hymamshu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Incarnat..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jackfrui..>2020-01-19 17:26 8.2K 
[TXT]school-info-Junior-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mystique..>2020-01-19 17:26 8.2K 
[TXT]school-info-Prayag-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Prerana-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Prerana-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Parijath..>2020-01-19 17:26 8.2K 
[TXT]school-info-Romasha-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Siksha-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Siksha-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shishu-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shraddha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Touch-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vistas-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-S-E--A--..>2020-01-19 17:26 8.2K 
[TXT]school-info-S-E-A--P..>2020-01-19 17:26 8.2K 
[TXT]school-info-IQRA-Int..>2020-01-19 17:26 8.2K 
[TXT]school-info-Al-Arafa..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sammar-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-BRAINY-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-BRAINY-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-BRAINY-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-BRAINY-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sesame-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sesame-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sesame-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sesame-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sesame-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sesame-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sesame-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sesame-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sesame-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sesame-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Al-Buroo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Elegant-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Elegant-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Naasih-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Zenith-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Rhiza-Ac..>2020-01-19 17:26 8.2K 
[TXT]school-info-Safari-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nurture-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Planet-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bethany-..>2020-01-19 17:26 8.2K 
[TXT]school-info-EDventur..>2020-01-19 17:26 8.2K 
[TXT]school-info-Asha-Kir..>2020-01-19 17:26 8.2K 
[TXT]school-info-Deepika-..>2020-01-19 17:26 8.2K 
[TXT]school-info-J-S-S-Sa..>2020-01-19 17:26 8.2K 
[TXT]school-info-Playstre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cottolen..>2020-01-19 17:26 8.2K 
[TXT]school-info-Arpana-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Fame-Ind..>2020-01-19 17:26 8.2K 
[TXT]school-info-Baldwin-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vydehi-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-VKIDS-Wh..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vydehi-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vydehi-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vydehi-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bangalor..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bubbles-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aruna-Ch..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Ruku..>2020-01-19 17:26 8.2K 
[TXT]school-info-Society-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Apoorva-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Christ-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pledge-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Spastics..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smart-Sc..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smart-Sc..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smart-Sc..>2020-01-19 17:26 8.2K 
[TXT]school-info-Arrowhea..>2020-01-19 17:26 8.2K 
[TXT]school-info-Samskrit..>2020-01-19 17:26 8.2K 
[TXT]school-info-Samskrit..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Lear..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Lear..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Lear..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Lear..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Lear..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Lear..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Camb..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Dunm..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cubby-Ta..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cubby-Ta..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cubby-Ta..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cubby-Ta..>2020-01-19 17:26 8.2K 
[TXT]school-info-VIVERO-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-Peaches-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Faro-Pla..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Litt..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Litt..>2020-01-19 17:26 8.2K 
[TXT]school-info-Blooming..>2020-01-19 17:26 8.2K 
[TXT]school-info-Grins-&-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Le-Dauph..>2020-01-19 17:26 8.2K 
[TXT]school-info-Le-Dauph..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nugen-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Panda-Gr..>2020-01-19 17:26 8.2K 
[TXT]school-info-Progress..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidoblis..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cute-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pride-Pr..>2020-01-19 17:26 8.2K 
[TXT]school-info-SMART-KI..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Man..>2020-01-19 17:26 8.2K 
[TXT]school-info-Twinkle-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aqua-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Spring-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Excellen..>2020-01-19 17:26 8.2K 
[TXT]school-info-PRECIOUS..>2020-01-19 17:26 8.2K 
[TXT]school-info-Trio-Tot..>2020-01-19 17:26 8.2K 
[TXT]school-info-Trio-Tot..>2020-01-19 17:26 8.2K 
[TXT]school-info-Alice-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-First-to..>2020-01-19 17:26 8.2K 
[TXT]school-info-First-to..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kiddys-N..>2020-01-19 17:26 8.2K 
[TXT]school-info-SERRA-IN..>2020-01-19 17:26 8.2K 
[TXT]school-info-SERRA-IN..>2020-01-19 17:26 8.2K 
[TXT]school-info-Young-Wo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Young-Wo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Young-Wo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Young-Wo..>2020-01-19 17:26 8.2K 
[TXT]school-info-KidSpace..>2020-01-19 17:26 8.2K 
[TXT]school-info-KidStree..>2020-01-19 17:26 8.2K 
[TXT]school-info-Billy-Be..>2020-01-19 17:26 8.2K 
[TXT]school-info-Child-De..>2020-01-19 17:26 8.2K 
[TXT]school-info-Inbloom-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Brain-Wo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Happy-Ho..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Kang..>2020-01-19 17:26 8.2K 
[TXT]school-info-Seven-Se..>2020-01-19 17:26 8.2K 
[TXT]school-info-Seven-Se..>2020-01-19 17:26 8.2K 
[TXT]school-info-Early-Sp..>2020-01-19 17:26 8.2K 
[TXT]school-info-World-of..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Viha-Pla..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kreyo-@-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mont-Ivy..>2020-01-19 17:26 8.2K 
[TXT]school-info-Esperanz..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kiddies-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Luv-and-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Luv-and-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Indus-Ea..>2020-01-19 17:26 8.2K 
[TXT]school-info-Indus-Ea..>2020-01-19 17:26 8.2K 
[TXT]school-info-Indus-Ea..>2020-01-19 17:26 8.2K 
[TXT]school-info-Basil-Wo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids360-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids360-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Littlewi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Baba-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Army-Bas..>2020-01-19 17:26 8.2K 
[TXT]school-info-TLC-Mont..>2020-01-19 17:26 8.2K 
[TXT]school-info-TLC-Mont..>2020-01-19 17:26 8.2K 
[TXT]school-info-TLC-Mont..>2020-01-19 17:26 8.2K 
[TXT]school-info-TLC-Mont..>2020-01-19 17:26 8.2K 
[TXT]school-info-Touchsto..>2020-01-19 17:26 8.2K 
[TXT]school-info-Touchsto..>2020-01-19 17:26 8.2K 
[TXT]school-info-Touchsto..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Lead-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Lead-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Lead-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-Rayen-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Prerana-..>2020-01-19 17:26 8.2K 
[TXT]school-info-kid's-wo..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Vist..>2020-01-19 17:26 8.2K 
[TXT]school-info-Blooming..>2020-01-19 17:26 8.2K 
[TXT]school-info-NAKSHATR..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-NeoVva-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vidyaram..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vidyaram..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vidyaram..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vidyaram..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vidyaram..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nancy's-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sparsha-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shanti-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shanti-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-Wings-Le..>2020-01-19 17:26 8.2K 
[TXT]school-info-Batwings..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sattva-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sattva-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Judes..>2020-01-19 17:26 8.2K 
[TXT]school-info-Matha-En..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gokul-Pr..>2020-01-19 17:26 8.2K 
[TXT]school-info-FUN-AND-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vivriti-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Samanvay..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Pear..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pramiti-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pramiti-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jain-Tod..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jain-Tod..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jain-Tod..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jain-Tod..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jain-Tod..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jain-Tod..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jain-Tod..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jain-Tod..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jain-Tod..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pravesh-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jelly-Be..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jelly-Be..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Mont..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Mont..>2020-01-19 17:26 8.2K 
[TXT]school-info-Learning..>2020-01-19 17:26 8.2K 
[TXT]school-info-Roots-Mo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Roots-Mo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Roots-Mo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Roots-Mo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Dots-Mon..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shishya-..>2020-01-19 17:26 8.2K 
[TXT]school-info-KidBees-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bodhi-Mo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Leo-Kids..>2020-01-19 17:26 8.2K 
[TXT]school-info-BIPS-–-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sankalpa..>2020-01-19 17:26 8.2K 
[TXT]school-info-Linden-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-L..>2020-01-19 17:26 8.2K 
[TXT]school-info-Abhyaas-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Footprin..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kingdom-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kingdom-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Special-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Winner-k..>2020-01-19 17:26 8.2K 
[TXT]school-info-Daysprin..>2020-01-19 17:26 8.2K 
[TXT]school-info-V-School..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vidyasag..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vidyasag..>2020-01-19 17:26 8.2K 
[TXT]school-info-EKA-Mont..>2020-01-19 17:26 8.2K 
[TXT]school-info-KARVE-Pr..>2020-01-19 17:26 8.2K 
[TXT]school-info-Joyous-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Blue..>2020-01-19 17:26 8.2K 
[TXT]school-info-Rich-Bra..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vivriti-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Giggles-..>2020-01-19 17:26 8.2K 
[TXT]school-info-MES-Nurs..>2020-01-19 17:26 8.2K 
[TXT]school-info-Green-Co..>2020-01-19 17:26 8.2K 
[TXT]school-info-Edu-Pedi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Edu-Pedi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Edu-Pedi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Edu-Pedi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Edu-Pedi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Edu-Pedi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Edu-Pedi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jigyasa-..>2020-01-19 17:26 8.2K 
[TXT]school-info-BEING-CH..>2020-01-19 17:26 8.2K 
[TXT]school-info-Rainbow-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzone-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Happy-Ho..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sapling-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Paripurn..>2020-01-19 17:26 8.2K 
[TXT]school-info-Small-Ha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Orange-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kiddies-..>2020-01-19 17:26 8.2K 
[TXT]school-info-little-s..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pavan-Mo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Einstein..>2020-01-19 17:26 8.2K 
[TXT]school-info-Soundary..>2020-01-19 17:26 8.2K 
[TXT]school-info-BRAINY-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Akshaya-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Anganawa..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vikas-Nu..>2020-01-19 17:26 8.2K 
[TXT]school-info-ENLIGHT-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Child's-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sanfort-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sanfort-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sanfort-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sanfort-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sanfort-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sanfort-..>2020-01-19 17:26 8.2K 
[TXT]school-info-MICKEY-N..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mathru-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Happy-Ti..>2020-01-19 17:26 8.2K 
[TXT]school-info-AL-Fitra..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sohaan-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Summer-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-Happy-Ho..>2020-01-19 17:26 8.2K 
[TXT]school-info-AL-Fitra..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Pupi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Noble-Sc..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-W..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chrysali..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gaia-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-MMA-Nurs..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Uni..>2020-01-19 17:26 8.2K 
[TXT]school-info-ncfe-Ear..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jacobs-L..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Vist..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Nes..>2020-01-19 17:26 8.2K 
[TXT]school-info-TeddyKid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Icon-kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-c..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-c..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-c..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smiling-..>2020-01-19 17:26 8.2K 
[TXT]school-info-MES-Nurs..>2020-01-19 17:26 8.2K 
[TXT]school-info-Giggles-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sampoorn..>2020-01-19 17:26 8.2K 
[TXT]school-info-Amba's-L..>2020-01-19 17:26 8.2K 
[TXT]school-info-Prem-Vit..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mia-Casa..>2020-01-19 17:26 8.2K 
[TXT]school-info-Lupin's-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Heritage..>2020-01-19 17:26 8.2K 
[TXT]school-info-Heritage..>2020-01-19 17:26 8.2K 
[TXT]school-info-Yuki-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pink-App..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Age-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Wise-i-p..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ashawini..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gurustha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gurustha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gurustha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gurustha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gurustha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gurustha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gurustha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gurustha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Seed-Int..>2020-01-19 17:26 8.2K 
[TXT]school-info-Unicus-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Sch..>2020-01-19 17:26 8.2K 
[TXT]school-info-THE-LEAR..>2020-01-19 17:26 8.2K 
[TXT]school-info-Krishnan..>2020-01-19 17:26 8.2K 
[TXT]school-info-Grace-St..>2020-01-19 17:26 8.2K 
[TXT]school-info-El-Santo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kinderda..>2020-01-19 17:26 8.2K 
[TXT]school-info-KEUPER-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-DAYCARE-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Green-Co..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aarco-Ir..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sparklin..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sparklin..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sparklin..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chimply-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Pri..>2020-01-19 17:26 8.2K 
[TXT]school-info-Visishta..>2020-01-19 17:26 8.2K 
[TXT]school-info-Visishta..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-V..>2020-01-19 17:26 8.2K 
[TXT]school-info-Twinkle-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Alpha-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-LITTLE-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidz-&-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-spring-b..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Litt..>2020-01-19 17:26 8.2K 
[TXT]school-info-Prerana-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Panchie-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Growing-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Growing-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Growing-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Growing-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-V..>2020-01-19 17:26 8.2K 
[TXT]school-info-Amelio-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Amelio-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Rainbow-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cherryca..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cherryca..>2020-01-19 17:26 8.2K 
[TXT]school-info-Azalea-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Advaita-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Kidz..>2020-01-19 17:26 8.2K 
[TXT]school-info-Papagoya..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidz-Tar..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kinder-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kinder-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kinder-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kinder-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kinder-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kinder-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-RedBridg..>2020-01-19 17:26 8.2K 
[TXT]school-info-RedBridg..>2020-01-19 17:26 8.2K 
[TXT]school-info-Purple-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-India-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-India-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-GEAR-Inn..>2020-01-19 17:26 8.2K 
[TXT]school-info-GEAR-Inn..>2020-01-19 17:26 8.2K 
[TXT]school-info-GEAR-Inn..>2020-01-19 17:26 8.2K 
[TXT]school-info-GEAR-Inn..>2020-01-19 17:26 8.2K 
[TXT]school-info-GEAR-Inn..>2020-01-19 17:26 8.2K 
[TXT]school-info-Silicon-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Anganvad..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pitter-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Rise-and..>2020-01-19 17:26 8.2K 
[TXT]school-info-i-wonder..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mother-L..>2020-01-19 17:26 8.2K 
[TXT]school-info-Wow-Kids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Wow-Kids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Wow-Kids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Wow-Kids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Star-Shi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Daisy-Mo..>2020-01-19 17:26 8.2K 
[TXT]school-info-WONDERLA..>2020-01-19 17:26 8.2K 
[TXT]school-info-Leo-cham..>2020-01-19 17:26 8.2K 
[TXT]school-info-Littlevi..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-King..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-R-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-LITTLE-R..>2020-01-19 17:26 8.2K 
[TXT]school-info-Alpine-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Care-and..>2020-01-19 17:26 8.2K 
[TXT]school-info-little-l..>2020-01-19 17:26 8.2K 
[TXT]school-info-Butterfl..>2020-01-19 17:26 8.2K 
[TXT]school-info-Foundati..>2020-01-19 17:26 8.2K 
[TXT]school-info-Educhamp..>2020-01-19 17:26 8.2K 
[TXT]school-info-Spectrum..>2020-01-19 17:26 8.2K 
[TXT]school-info-Golabus-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Merry-Hi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Rishima-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Carousel..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bamana-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-SouthSid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kinder-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kinder-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-CHERUB-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Trushna-..>2020-01-19 17:26 8.2K 
[TXT]school-info-KIDSVILL..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aleph-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ashwini-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Trillium..>2020-01-19 17:26 8.2K 
[TXT]school-info-Wonderki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sanskrit..>2020-01-19 17:26 8.2K 
[TXT]school-info-Panda-Gr..>2020-01-19 17:26 8.2K 
[TXT]school-info-L-R-Inte..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-F..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nimai-Mo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nitai-Ni..>2020-01-19 17:26 8.2K 
[TXT]school-info-INSPIRO-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tots-Pla..>2020-01-19 17:26 8.2K 
[TXT]school-info-Alpha-Pr..>2020-01-19 17:26 8.2K 
[TXT]school-info-HappyDay..>2020-01-19 17:26 8.2K 
[TXT]school-info-J-M-S-Da..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kinder-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-Children..>2020-01-19 17:26 8.2K 
[TXT]school-info-Railway-..>2020-01-19 17:26 8.2K 
[TXT]school-info-KINDER-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-Busy-bee..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidorabl..>2020-01-19 17:26 8.2K 
[TXT]school-info-A-Step-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Rainbow-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Beehive-..>2020-01-19 17:26 8.2K 
[TXT]school-info-A&A-Pres..>2020-01-19 17:26 8.2K 
[TXT]school-info-First-Gu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bubbly-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Green-Or..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aanggan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aanggan-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tiny-Tho..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kuteer-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sweethea..>2020-01-19 17:26 8.2K 
[TXT]school-info-Santiago..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sivaana-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Blooming..>2020-01-19 17:26 8.2K 
[TXT]school-info-Feathert..>2020-01-19 17:26 8.2K 
[TXT]school-info-Feathert..>2020-01-19 17:26 8.2K 
[TXT]school-info-Feathert..>2020-01-19 17:26 8.2K 
[TXT]school-info-Feathert..>2020-01-19 17:26 8.2K 
[TXT]school-info-Feathert..>2020-01-19 17:26 8.2K 
[TXT]school-info-Feathert..>2020-01-19 17:26 8.2K 
[TXT]school-info-Prasiddh..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jingels-..>2020-01-19 17:26 8.2K 
[TXT]school-info-IRA-PLAY..>2020-01-19 17:26 8.2K 
[TXT]school-info-Keykidz-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Keykidz-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aakruti-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Lords-En..>2020-01-19 17:26 8.2K 
[TXT]school-info-Alphabet..>2020-01-19 17:26 8.2K 
[TXT]school-info-Alphabet..>2020-01-19 17:26 8.2K 
[TXT]school-info-TWINKLIN..>2020-01-19 17:26 8.2K 
[TXT]school-info-Littleda..>2020-01-19 17:26 8.2K 
[TXT]school-info-Dewdrops..>2020-01-19 17:26 8.2K 
[TXT]school-info-Strings-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Madhura-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Mil..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sacred-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-WeeHive-..>2020-01-19 17:26 8.2K 
[TXT]school-info-ARK's-Su..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tots-N-T..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aady-&-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shanthin..>2020-01-19 17:26 8.2K 
[TXT]school-info-SHANTHIN..>2020-01-19 17:26 8.2K 
[TXT]school-info-SAINT-TE..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kiwi-Kid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chiranta..>2020-01-19 17:26 8.2K 
[TXT]school-info-Periwink..>2020-01-19 17:26 8.2K 
[TXT]school-info-Periwink..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pragyaa-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Akshaya-..>2020-01-19 17:26 8.2K 
[TXT]school-info-SAA-Nurs..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bangalor..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aim-Mont..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Spa..>2020-01-19 17:26 8.2K 
[TXT]school-info-HONEY-BE..>2020-01-19 17:26 8.2K 
[TXT]school-info-Start-Sm..>2020-01-19 17:26 8.2K 
[TXT]school-info-footprin..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Royale-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gurukula..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gurukula..>2020-01-19 17:26 8.2K 
[TXT]school-info-Goody-Go..>2020-01-19 17:26 8.2K 
[TXT]school-info-Udaan-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-Karve-Pr..>2020-01-19 17:26 8.2K 
[TXT]school-info-Busy-Bab..>2020-01-19 17:26 8.2K 
[TXT]school-info-MONKEYNA..>2020-01-19 17:26 8.2K 
[TXT]school-info-Discover..>2020-01-19 17:26 8.2K 
[TXT]school-info-Discover..>2020-01-19 17:26 8.2K 
[TXT]school-info-Discover..>2020-01-19 17:26 8.2K 
[TXT]school-info-BLOOMING..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vivid-Pr..>2020-01-19 17:26 8.2K 
[TXT]school-info-Unique-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-F..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ankura-F..>2020-01-19 17:26 8.2K 
[TXT]school-info-HI-TECH-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bala-Vik..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bala-Vik..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-SOPHI..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Kar..>2020-01-19 17:26 8.2K 
[TXT]school-info-BLUE-HIL..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hopstart..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Kas..>2020-01-19 17:26 8.2K 
[TXT]school-info-First-Im..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kadbury-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Compass-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Muddiee-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Seshadri..>2020-01-19 17:26 8.2K 
[TXT]school-info-Future-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smiling-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cambridg..>2020-01-19 17:26 8.2K 
[TXT]school-info-RedWood-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Par..>2020-01-19 17:26 8.2K 
[TXT]school-info-First-Gu..>2020-01-19 17:26 8.2K 
[TXT]school-info-First-Gu..>2020-01-19 17:26 8.2K 
[TXT]school-info-First-Gu..>2020-01-19 17:26 8.2K 
[TXT]school-info-First-Gu..>2020-01-19 17:26 8.2K 
[TXT]school-info-First-Gu..>2020-01-19 17:26 8.2K 
[TXT]school-info-First-Gu..>2020-01-19 17:26 8.2K 
[TXT]school-info-First-Gu..>2020-01-19 17:26 8.2K 
[TXT]school-info-First-Gu..>2020-01-19 17:26 8.2K 
[TXT]school-info-First-Gu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cocoon-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Your-Bab..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cuckoo's..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cordial-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Volante-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Enjoy-Le..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sacred-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cherry-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Budding-..>2020-01-19 17:26 8.2K 
[TXT]school-info-First-St..>2020-01-19 17:26 8.2K 
[TXT]school-info-First-St..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kamala-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-KODOMO-k..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bodhikid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Rinku-Nu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Toddlers..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-O..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bells-Mo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Blooming..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Kidu..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Gene..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Age-..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Litt..>2020-01-19 17:26 8.2K 
[TXT]school-info-Footprin..>2020-01-19 17:26 8.2K 
[TXT]school-info-Footprin..>2020-01-19 17:26 8.2K 
[TXT]school-info-Footprin..>2020-01-19 17:26 8.2K 
[TXT]school-info-Footprin..>2020-01-19 17:26 8.2K 
[TXT]school-info-Footprin..>2020-01-19 17:26 8.2K 
[TXT]school-info-V3-Kids-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Towering..>2020-01-19 17:26 8.2K 
[TXT]school-info-Winnie-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ankur-Pl..>2020-01-19 17:26 8.2K 
[TXT]school-info-Harvest-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Heritage..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pinewood..>2020-01-19 17:26 8.2K 
[TXT]school-info-M--A--M-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kingston..>2020-01-19 17:26 8.2K 
[TXT]school-info-Blossom-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Twinkle-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Baby-Sen..>2020-01-19 17:26 8.2K 
[TXT]school-info-Baby-Sen..>2020-01-19 17:26 8.2K 
[TXT]school-info-Baby-Sen..>2020-01-19 17:26 8.2K 
[TXT]school-info-Child-De..>2020-01-19 17:26 8.2K 
[TXT]school-info-Janani-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Lumino-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Lumino-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Neurth-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Venus-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Creative..>2020-01-19 17:26 8.2K 
[TXT]school-info-Creative..>2020-01-19 17:26 8.2K 
[TXT]school-info-Creative..>2020-01-19 17:26 8.2K 
[TXT]school-info-Creative..>2020-01-19 17:26 8.2K 
[TXT]school-info-Creative..>2020-01-19 17:26 8.2K 
[TXT]school-info-Creative..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Beeh..>2020-01-19 17:26 8.2K 
[TXT]school-info-Children..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Aca..>2020-01-19 17:26 8.2K 
[TXT]school-info-FLORENCE..>2020-01-19 17:26 8.2K 
[TXT]school-info-Edify-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Edify-Sc..>2020-01-19 17:26 8.2K 
[TXT]school-info-Lily-Pie..>2020-01-19 17:26 8.2K 
[TXT]school-info-Spoorthy..>2020-01-19 17:26 8.2K 
[TXT]school-info-Eency-We..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzz-Bu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ragersvi..>2020-01-19 17:26 8.2K 
[TXT]school-info-V-Rise-&..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kinder-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-STAR-FEE..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ayesha-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Maven's-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Li'l-But..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kites-Pr..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sparrows..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sand-&-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Starkids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Butterfl..>2020-01-19 17:26 8.2K 
[TXT]school-info-Future-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Petals-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sky-Kids..>2020-01-19 17:26 8.2K 
[TXT]school-info-CHERUB-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Olive-Ga..>2020-01-19 17:26 8.2K 
[TXT]school-info-little-g..>2020-01-19 17:26 8.2K 
[TXT]school-info-Prakriti..>2020-01-19 17:26 8.2K 
[TXT]school-info-Future-R..>2020-01-19 17:26 8.2K 
[TXT]school-info-Future-R..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nurture-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nurture-..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Natu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kiddie-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-Rising-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-CAMBRIDG..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mud-Pie-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kinderpi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sharp-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-MyChild-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Patel-Pu..>2020-01-19 17:26 8.2K 
[TXT]school-info-De-New-W..>2020-01-19 17:26 8.2K 
[TXT]school-info-Eshwari-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tulips-T..>2020-01-19 17:26 8.2K 
[TXT]school-info-Blossom-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jump-Sta..>2020-01-19 17:26 8.2K 
[TXT]school-info-RAKSHA-L..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Jose..>2020-01-19 17:26 8.2K 
[TXT]school-info-Amma's-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Pla..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sparsha-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kinder-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cambridg..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Elim-Chi..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Pres..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Atel..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shemrock..>2020-01-19 17:26 8.2K 
[TXT]school-info-Floretz-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Elements..>2020-01-19 17:26 8.2K 
[TXT]school-info-Growingt..>2020-01-19 17:26 8.2K 
[TXT]school-info-Growingt..>2020-01-19 17:26 8.2K 
[TXT]school-info-Growingt..>2020-01-19 17:26 8.2K 
[TXT]school-info-Growingt..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-TLC-Mont..>2020-01-19 17:26 8.2K 
[TXT]school-info-TLC-Mont..>2020-01-19 17:26 8.2K 
[TXT]school-info-Small-Wo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Rainbow-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Good-She..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nebula-e..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aerokids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Karthik-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Darling-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Learn-'N..>2020-01-19 17:26 8.2K 
[TXT]school-info-Rishitha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Twinkle-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Spruce-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-IVYKREST..>2020-01-19 17:26 8.2K 
[TXT]school-info-IVYKREST..>2020-01-19 17:26 8.2K 
[TXT]school-info-IVYKREST..>2020-01-19 17:26 8.2K 
[TXT]school-info-IVYKREST..>2020-01-19 17:26 8.2K 
[TXT]school-info-IVYKREST..>2020-01-19 17:26 8.2K 
[TXT]school-info-IVYKREST..>2020-01-19 17:26 8.2K 
[TXT]school-info-REVA-KID..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shiksha-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Infant-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-CHILDREN..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidsking..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ikidz-Pr..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidza-Pr..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Childs'-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shalom-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Prabhash..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Mary'..>2020-01-19 17:26 8.2K 
[TXT]school-info-Air-Forc..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Bhav..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mother-T..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Devi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vathsaly..>2020-01-19 17:26 8.2K 
[TXT]school-info-Disney-N..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kiddy-La..>2020-01-19 17:26 8.2K 
[TXT]school-info-Internat..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Sch..>2020-01-19 17:26 8.2K 
[TXT]school-info-Learn-'N..>2020-01-19 17:26 8.2K 
[TXT]school-info-Genius-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mileston..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-Treamis-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tulips-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sunrise-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sunrise-..>2020-01-19 17:26 8.2K 
[TXT]school-info-SSVN-Pub..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chinmaye..>2020-01-19 17:26 8.2K 
[TXT]school-info-ILM-Mont..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gigglezz..>2020-01-19 17:26 8.2K 
[TXT]school-info-NURTURE-..>2020-01-19 17:26 8.2K 
[TXT]school-info-KREEDO--..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pollinat..>2020-01-19 17:26 8.2K 
[TXT]school-info-5Tattvaa..>2020-01-19 17:26 8.2K 
[TXT]school-info-Prathama..>2020-01-19 17:26 8.2K 
[TXT]school-info-Srishti-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-K-R-L-S-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Domlur-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-NITTE-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cauvery-..>2020-01-19 17:26 8.2K 
[TXT]school-info-SCHOLARS..>2020-01-19 17:26 8.2K 
[TXT]school-info-Green-Co..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Auro..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mastery-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sahakarn..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Marti..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vidya-So..>2020-01-19 17:26 8.2K 
[TXT]school-info-PES-Engl..>2020-01-19 17:26 8.2K 
[TXT]school-info-PES-High..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sunrise-..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Mary'..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bomailla..>2020-01-19 17:26 8.2K 
[TXT]school-info-Discover..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Podar-Ju..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cub..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cub..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cub..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cub..>2020-01-19 17:26 8.2K 
[TXT]school-info-Unique-T..>2020-01-19 17:26 8.2K 
[TXT]school-info-Unique-T..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidz-pat..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidz-pat..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidz-pat..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narayana..>2020-01-19 17:26 8.2K 
[TXT]school-info-School-o..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Samh..>2020-01-19 17:26 8.2K 
[TXT]school-info-BVM-Glob..>2020-01-19 17:26 8.2K 
[TXT]school-info-BVM-Glob..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sudarsha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sudarsha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sudarsha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Advaitam..>2020-01-19 17:26 8.2K 
[TXT]school-info-MLA-Engl..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nisarga-..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-O-Kids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tiny-Tot..>2020-01-19 17:26 8.2K 
[TXT]school-info-Stella-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Vidy..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aakriti-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hymamshu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hymamshu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hymamshu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hymamshu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Christ-T..>2020-01-19 17:26 8.2K 
[TXT]school-info-MES-KK-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-MES-Kish..>2020-01-19 17:26 8.2K 
[TXT]school-info-MES-MPLS..>2020-01-19 17:26 8.2K 
[TXT]school-info-MES-PU-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Vyal..>2020-01-19 17:26 8.2K 
[TXT]school-info-Garden-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bangalor..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bangalor..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bangalor..>2020-01-19 17:26 8.2K 
[TXT]school-info-M-S-V-Hi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bala-Man..>2020-01-19 17:26 8.2K 
[TXT]school-info-Diya-Mon..>2020-01-19 17:26 8.2K 
[TXT]school-info-DIYA-PRI..>2020-01-19 17:26 8.2K 
[TXT]school-info-DIYA-SEC..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Bril..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Tere..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Anto..>2020-01-19 17:26 8.2K 
[TXT]school-info-ST--ANTO..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Anto..>2020-01-19 17:26 8.2K 
[TXT]school-info-Samuel-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shree-Ve..>2020-01-19 17:26 8.2K 
[TXT]school-info-Princeto..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sarvoday..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-VISHWA-V..>2020-01-19 17:26 8.2K 
[TXT]school-info-Goodwill..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Mary'..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vidya-Ke..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Anup..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Stan..>2020-01-19 17:26 8.2K 
[TXT]school-info-Luminary..>2020-01-19 17:26 8.2K 
[TXT]school-info-L-G-Nati..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mathrush..>2020-01-19 17:26 8.2K 
[TXT]school-info-Arvind-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Vidh..>2020-01-19 17:26 8.2K 
[TXT]school-info-Karnatak..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sai-Vidy..>2020-01-19 17:26 8.2K 
[TXT]school-info-MM-Dhanu..>2020-01-19 17:26 8.2K 
[TXT]school-info-MM-Brigh..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shushrut..>2020-01-19 17:26 8.2K 
[TXT]school-info-Peenya-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-D-M-Publ..>2020-01-19 17:26 8.2K 
[TXT]school-info-Schoenst..>2020-01-19 17:26 8.2K 
[TXT]school-info-RV-Schoo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Klay-Pre..>2020-01-19 17:26 8.2K 
[TXT]school-info-SM-ENGLI..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-TINY-TOW..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-NATURE-O..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bodhi-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Blossom-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Holy-Inf..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shaarade..>2020-01-19 17:26 8.2K 
[TXT]school-info-Blossom-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Blossom-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Hars..>2020-01-19 17:26 8.2K 
[TXT]school-info-MES-Scho..>2020-01-19 17:26 8.2K 
[TXT]school-info-MES-Nurs..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--phil..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-India-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mount-Li..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mount-Li..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mount-Li..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tadmore-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chrysali..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Fran..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-India-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tadmore-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chrysali..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Fran..>2020-01-19 17:26 8.2K 
[TXT]school-info-First-St..>2020-01-19 17:26 8.2K 
[TXT]school-info-Indian-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nalanda-..>2020-01-19 17:26 8.2K 
[TXT]school-info-National..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Phil..>2020-01-19 17:26 8.2K 
[TXT]school-info-SSM-Publ..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Auro..>2020-01-19 17:26 8.2K 
[TXT]school-info-SRI-CHEN..>2020-01-19 17:26 8.2K 
[TXT]school-info-S-V-C-K-..>2020-01-19 17:26 8.2K 
[TXT]school-info-SRI-VENK..>2020-01-19 17:26 8.2K 
[TXT]school-info-S-S-M--P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kamala-N..>2020-01-19 17:26 8.2K 
[TXT]school-info-Navodaya..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vismayaa..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vasavi-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-Lakshmi-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Holy-Chi..>2020-01-19 17:26 8.2K 
[TXT]school-info-SSME-Sch..>2020-01-19 17:26 8.2K 
[TXT]school-info-Swami-Vi..>2020-01-19 17:26 8.2K 
[TXT]school-info-JSS-Publ..>2020-01-19 17:26 8.2K 
[TXT]school-info-Best-Hig..>2020-01-19 17:26 8.2K 
[TXT]school-info-Grace-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-Maxwell-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Heritage..>2020-01-19 17:26 8.2K 
[TXT]school-info-Wisdom-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-S-V-N--E..>2020-01-19 17:26 8.2K 
[TXT]school-info-VIVERO-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Sri-..>2020-01-19 17:26 8.2K 
[TXT]school-info-JSS-Publ..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jawahar-..>2020-01-19 17:26 8.2K 
[TXT]school-info-East-Wes..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Vidy..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shanthin..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shantini..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shantini..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nighting..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ravindra..>2020-01-19 17:26 8.2K 
[TXT]school-info-Teresa-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Srinidhi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Radcliff..>2020-01-19 17:26 8.2K 
[TXT]school-info-Attibele..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Phil..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Phil..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Phil..>2020-01-19 17:26 8.2K 
[TXT]school-info-KLS-Inte..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Domi..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Beth..>2020-01-19 17:26 8.2K 
[TXT]school-info-sharada-..>2020-01-19 17:26 8.2K 
[TXT]school-info-SHREE-VI..>2020-01-19 17:26 8.2K 
[TXT]school-info-SHREE-VI..>2020-01-19 17:26 8.2K 
[TXT]school-info-SHREE-VI..>2020-01-19 17:26 8.2K 
[TXT]school-info-Canara-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bethel-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Swamy-Vi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Jaya..>2020-01-19 17:26 8.2K 
[TXT]school-info-Navodaya..>2020-01-19 17:26 8.2K 
[TXT]school-info-Carmel-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kengeri-..>2020-01-19 17:26 8.2K 
[TXT]school-info-SJR-Keng..>2020-01-19 17:26 8.2K 
[TXT]school-info-BGS-Publ..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nazareth..>2020-01-19 17:26 8.2K 
[TXT]school-info-Lorven-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Lorven-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Lorven-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Green-do..>2020-01-19 17:26 8.2K 
[TXT]school-info-School-V..>2020-01-19 17:26 8.2K 
[TXT]school-info-Rashtrot..>2020-01-19 17:26 8.2K 
[TXT]school-info-Rashtrot..>2020-01-19 17:26 8.2K 
[TXT]school-info-Rashtrot..>2020-01-19 17:26 8.2K 
[TXT]school-info-JAIGOPAL..>2020-01-19 17:26 8.2K 
[TXT]school-info-Champion..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Prat..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sunflowe..>2020-01-19 17:26 8.2K 
[TXT]school-info-Douglas-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Auxilium..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kusuma-T..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-SIP-Abac..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-GULPS-An..>2020-01-19 17:26 8.2K 
[TXT]school-info-MVS-Engl..>2020-01-19 17:26 8.2K 
[TXT]school-info-Florence..>2020-01-19 17:26 8.2K 
[TXT]school-info-Magik-Mo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Presiden..>2020-01-19 17:26 8.2K 
[TXT]school-info-Twinkler..>2020-01-19 17:26 8.2K 
[TXT]school-info-Twinkler..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Moth..>2020-01-19 17:26 8.2K 
[TXT]school-info-Holy-Mot..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kembatha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jubilee-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Dream-On..>2020-01-19 17:26 8.2K 
[TXT]school-info-Oriental..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gulabi-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-Royal-En..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sophia-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-Excellen..>2020-01-19 17:26 8.2K 
[TXT]school-info-Benhur-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-Good-Hop..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bethany-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Royal-En..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Ayya..>2020-01-19 17:26 8.2K 
[TXT]school-info-Najmussh..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bambino-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Acme-Glo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Oxford-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Islamic-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Florence..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Alpho..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jack-and..>2020-01-19 17:26 8.2K 
[TXT]school-info-Quwathul..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tiny-Tot..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Mary-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Unique-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vidya-Vi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Rainbow-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sree-Ayy..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jindal-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Abbigere..>2020-01-19 17:26 8.2K 
[TXT]school-info-Silver-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Daniel-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ashok-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-Venky's-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Swam..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kites-Ac..>2020-01-19 17:26 8.2K 
[TXT]school-info-Radhakri..>2020-01-19 17:26 8.2K 
[TXT]school-info-Millenni..>2020-01-19 17:26 8.2K 
[TXT]school-info-Masumeen..>2020-01-19 17:26 8.2K 
[TXT]school-info-Govt-Urd..>2020-01-19 17:26 8.2K 
[TXT]school-info-Children..>2020-01-19 17:26 8.2K 
[TXT]school-info-sun-rise..>2020-01-19 17:26 8.2K 
[TXT]school-info-VidyaSag..>2020-01-19 17:26 8.2K 
[TXT]school-info-VidyaSag..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kid-'Z'-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Indus-Pr..>2020-01-19 17:26 8.2K 
[TXT]school-info-Madarsa-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kuvempu-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sadashiv..>2020-01-19 17:26 8.2K 
[TXT]school-info-Krsna-Mo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cambridg..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tamil-Sc..>2020-01-19 17:26 8.2K 
[TXT]school-info-First-Di..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mi-Kids-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nirmala-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Wisdom-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-Metropol..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mountcre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Saint-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-PNC-Cogn..>2020-01-19 17:26 8.2K 
[TXT]school-info-Deens-ac..>2020-01-19 17:26 8.2K 
[TXT]school-info-Geethanj..>2020-01-19 17:26 8.2K 
[TXT]school-info-Assisi-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Hori..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chistiya..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kendriya..>2020-01-19 17:26 8.2K 
[TXT]school-info-BMN-PUBL..>2020-01-19 17:26 8.2K 
[TXT]school-info-Emerald-..>2020-01-19 17:26 8.2K 
[TXT]school-info-MSV-Publ..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Cent..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Smar..>2020-01-19 17:26 8.2K 
[TXT]school-info-Soundary..>2020-01-19 17:26 8.2K 
[TXT]school-info-BGS-Worl..>2020-01-19 17:26 8.2K 
[TXT]school-info-Presiden..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gnana-Jy..>2020-01-19 17:26 8.2K 
[TXT]school-info-Capstone..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-R..>2020-01-19 17:26 8.2K 
[TXT]school-info-Geetanja..>2020-01-19 17:26 8.2K 
[TXT]school-info-Capstone..>2020-01-19 17:26 8.2K 
[TXT]school-info-Indian-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Metropol..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Benhur-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-Indian-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-SN-Engli..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shanthin..>2020-01-19 17:26 8.2K 
[TXT]school-info-Info-Sch..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Musi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Avinash-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Padmavat..>2020-01-19 17:26 8.2K 
[TXT]school-info-RK-Schoo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sarkari-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sathya-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-AMB-Publ..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vijaya-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Indian-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nehru-Ce..>2020-01-19 17:26 8.2K 
[TXT]school-info-Newton-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Subhash-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Subhash-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Subhash-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Subhash-..>2020-01-19 17:26 8.2K 
[TXT]school-info-NEWTON-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-NEWTON-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-NEWTON-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-NEWTON-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-NEWTON-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-H-P--NEW..>2020-01-19 17:26 8.2K 
[TXT]school-info-NEWTON-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-ST-THERE..>2020-01-19 17:26 8.2K 
[TXT]school-info-Goodwill..>2020-01-19 17:26 8.2K 
[TXT]school-info-Young-Sc..>2020-01-19 17:26 8.2K 
[TXT]school-info-Genius-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Swathi-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Florida-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Paramoun..>2020-01-19 17:26 8.2K 
[TXT]school-info-Paramoun..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nehru-Pu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sathya-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vijaya-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Lords-Sc..>2020-01-19 17:26 8.2K 
[TXT]school-info-Achala-V..>2020-01-19 17:26 8.2K 
[TXT]school-info-Samartha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Samartha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Samartha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Samartha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Samartha..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mother-T..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Pete..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Marin..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pragathi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nustle-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-MTB-Jnan..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Anne'..>2020-01-19 17:26 8.2K 
[TXT]school-info-Twinkler..>2020-01-19 17:26 8.2K 
[TXT]school-info-Florance..>2020-01-19 17:26 8.2K 
[TXT]school-info-Florence..>2020-01-19 17:26 8.2K 
[TXT]school-info-BMP-Scho..>2020-01-19 17:26 8.2K 
[TXT]school-info-Adarsh-V..>2020-01-19 17:26 8.2K 
[TXT]school-info-Dhee-Glo..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Georg..>2020-01-19 17:26 8.2K 
[TXT]school-info-G-K-Naid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bright-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shiksha-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Capital-..>2020-01-19 17:26 8.2K 
[TXT]school-info-National..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jubilee-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Chai..>2020-01-19 17:26 8.2K 
[TXT]school-info-METRO-PU..>2020-01-19 17:26 8.2K 
[TXT]school-info-Twinkler..>2020-01-19 17:26 8.2K 
[TXT]school-info-Glitzy-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shishya-..>2020-01-19 17:26 8.2K 
[TXT]school-info-National..>2020-01-19 17:26 8.2K 
[TXT]school-info-National..>2020-01-19 17:26 8.2K 
[TXT]school-info-Josco-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nadgir-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Priyadar..>2020-01-19 17:26 8.2K 
[TXT]school-info-BGS-Inte..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vidya-Bh..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vishwa-V..>2020-01-19 17:26 8.2K 
[TXT]school-info-RAIN-TRE..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shree-Sw..>2020-01-19 17:26 8.2K 
[TXT]school-info-National..>2020-01-19 17:26 8.2K 
[TXT]school-info-MEC-Publ..>2020-01-19 17:26 8.2K 
[TXT]school-info-Auro-Mir..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Meer..>2020-01-19 17:26 8.2K 
[TXT]school-info-Lourdes-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Eastwood..>2020-01-19 17:26 8.2K 
[TXT]school-info-National..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aavishka..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kairalee..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sree-Cau..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chinmaya..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ramakris..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Guru..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sree-Cau..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tagore-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Divine-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Dev-Mata..>2020-01-19 17:26 8.2K 
[TXT]school-info-Dev-Mata..>2020-01-19 17:26 8.2K 
[TXT]school-info-Dev-Mata..>2020-01-19 17:26 8.2K 
[TXT]school-info-SK-PUBLI..>2020-01-19 17:26 8.2K 
[TXT]school-info-Pavithra..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Thoma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vidya-va..>2020-01-19 17:26 8.2K 
[TXT]school-info-BS-Carme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sharada-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-D--Ameri..>2020-01-19 17:26 8.2K 
[TXT]school-info-B-T-L--H..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hebbagod..>2020-01-19 17:26 8.2K 
[TXT]school-info-NM-Memor..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chikkaja..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-venk..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jagruti-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidz-Car..>2020-01-19 17:26 8.2K 
[TXT]school-info-MD-FAROO..>2020-01-19 17:26 8.2K 
[TXT]school-info-Katherin..>2020-01-19 17:26 8.2K 
[TXT]school-info-Higher-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Embassy-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Gurukula..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shanti-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shanti-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shanti-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shanti-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shanti-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shanti-J..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bharathi..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Agne..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bangalor..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Euphr..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Antho..>2020-01-19 17:26 8.2K 
[TXT]school-info-Stracey-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tunbridg..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Imamia-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Educhamp..>2020-01-19 17:26 8.2K 
[TXT]school-info-Educhamp..>2020-01-19 17:26 8.2K 
[TXT]school-info-Educhamp..>2020-01-19 17:26 8.2K 
[TXT]school-info-Educhamp..>2020-01-19 17:26 8.2K 
[TXT]school-info-Educhamp..>2020-01-19 17:26 8.2K 
[TXT]school-info-Educhamp..>2020-01-19 17:26 8.2K 
[TXT]school-info-Educhamp..>2020-01-19 17:26 8.2K 
[TXT]school-info-Educhamp..>2020-01-19 17:26 8.2K 
[TXT]school-info-Educhamp..>2020-01-19 17:26 8.2K 
[TXT]school-info-Educhamp..>2020-01-19 17:26 8.2K 
[TXT]school-info-Educhamp..>2020-01-19 17:26 8.2K 
[TXT]school-info-Educhamp..>2020-01-19 17:26 8.2K 
[TXT]school-info-Educhamp..>2020-01-19 17:26 8.2K 
[TXT]school-info-Educhamp..>2020-01-19 17:26 8.2K 
[TXT]school-info-Educhamp..>2020-01-19 17:26 8.2K 
[TXT]school-info-Educhamp..>2020-01-19 17:26 8.2K 
[TXT]school-info-Educhamp..>2020-01-19 17:26 8.2K 
[TXT]school-info-Karnatak..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shikha-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Capitol-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Saamar-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-Brighton..>2020-01-19 17:26 8.2K 
[TXT]school-info-Loretta-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Royal-En..>2020-01-19 17:26 8.2K 
[TXT]school-info-Maithry-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ravindra..>2020-01-19 17:26 8.2K 
[TXT]school-info-KMV-Red-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mahesh-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-BEL-Scho..>2020-01-19 17:26 8.2K 
[TXT]school-info-Deva-Mat..>2020-01-19 17:26 8.2K 
[TXT]school-info-Navapraj..>2020-01-19 17:26 8.2K 
[TXT]school-info-Glentree..>2020-01-19 17:26 8.2K 
[TXT]school-info-Glentree..>2020-01-19 17:26 8.2K 
[TXT]school-info-Holy-Cro..>2020-01-19 17:26 8.2K 
[TXT]school-info-KSVK-Eng..>2020-01-19 17:26 8.2K 
[TXT]school-info-JES-Publ..>2020-01-19 17:26 8.2K 
[TXT]school-info-Siddagan..>2020-01-19 17:26 8.2K 
[TXT]school-info-Aryan-Pr..>2020-01-19 17:26 8.2K 
[TXT]school-info-Malgudi-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jubilee-..>2020-01-19 17:26 8.2K 
[TXT]school-info-K-L-E-So..>2020-01-19 17:26 8.2K 
[TXT]school-info-SORSFORT..>2020-01-19 17:26 8.2K 
[TXT]school-info-D-AMERIC..>2020-01-19 17:26 8.2K 
[TXT]school-info-Spurthy-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jaigopal..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Aloy..>2020-01-19 17:26 8.2K 
[TXT]school-info-Higher-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-HMR-Inte..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bangalor..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bangalor..>2020-01-19 17:26 8.2K 
[TXT]school-info-Brooklan..>2020-01-19 17:26 8.2K 
[TXT]school-info-Brooklan..>2020-01-19 17:26 8.2K 
[TXT]school-info-Brooklan..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Lead-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Lead-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-I-Lead-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-Oranges-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chrysali..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chrysali..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chrysali..>2020-01-19 17:26 8.2K 
[TXT]school-info-Footprin..>2020-01-19 17:26 8.2K 
[TXT]school-info-Footprin..>2020-01-19 17:26 8.2K 
[TXT]school-info-Footprin..>2020-01-19 17:26 8.2K 
[TXT]school-info-Footprin..>2020-01-19 17:26 8.2K 
[TXT]school-info-Footprin..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sinclair..>2020-01-19 17:26 8.2K 
[TXT]school-info-Twinkle-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Twinkle-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shishu-V..>2020-01-19 17:26 8.2K 
[TXT]school-info-HAL-GNAN..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bharathi..>2020-01-19 17:26 8.2K 
[TXT]school-info-C-B-Bhan..>2020-01-19 17:26 8.2K 
[TXT]school-info-C-M-A-Bo..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shri-Pat..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Cathe..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narendra..>2020-01-19 17:26 8.2K 
[TXT]school-info-STI-High..>2020-01-19 17:26 8.2K 
[TXT]school-info-Adarsh-V..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Vija..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kamala-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Akshara-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Girls-Hi..>2020-01-19 17:26 8.2K 
[TXT]school-info-D-V-V-Hi..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Rohit..>2020-01-19 17:26 8.2K 
[TXT]school-info-Harvard-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Prayatna..>2020-01-19 17:26 8.2K 
[TXT]school-info-Prayatna..>2020-01-19 17:26 8.2K 
[TXT]school-info-Best-Eng..>2020-01-19 17:26 8.2K 
[TXT]school-info-Geeth-Hi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Medh..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Paul'..>2020-01-19 17:26 8.2K 
[TXT]school-info-Standard..>2020-01-19 17:26 8.2K 
[TXT]school-info-Preethi-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Divya-Sh..>2020-01-19 17:26 8.2K 
[TXT]school-info-YuvaLok-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Sidd..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sinclair..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sinclair..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mudra-Ac..>2020-01-19 17:26 8.2K 
[TXT]school-info-Prakriya..>2020-01-19 17:26 8.2K 
[TXT]school-info-Anweshan..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Marys..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smt-Kama..>2020-01-19 17:26 8.2K 
[TXT]school-info-Yuvaka-V..>2020-01-19 17:26 8.2K 
[TXT]school-info-Amora-Mo..>2020-01-19 17:26 8.2K 
[TXT]school-info-PVD-High..>2020-01-19 17:26 8.2K 
[TXT]school-info-Llttle-B..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ram-Gopa..>2020-01-19 17:26 8.2K 
[TXT]school-info-BRIGHT-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mookambi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Institut..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mother-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mother-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Saint-Th..>2020-01-19 17:26 8.2K 
[TXT]school-info-Holy-Cro..>2020-01-19 17:26 8.2K 
[TXT]school-info-Holy-Cro..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Con..>2020-01-19 17:26 8.2K 
[TXT]school-info-Capitol-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Capitol-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nandana-..>2020-01-19 17:26 8.2K 
[TXT]school-info-iBloom-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Prajapit..>2020-01-19 17:26 8.2K 
[TXT]school-info-Repton-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Repton-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Sarv..>2020-01-19 17:26 8.2K 
[TXT]school-info-New-Bhar..>2020-01-19 17:26 8.2K 
[TXT]school-info-Chethana..>2020-01-19 17:26 8.2K 
[TXT]school-info-SRI-VENK..>2020-01-19 17:26 8.2K 
[TXT]school-info-SRI-VENK..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-VENK..>2020-01-19 17:26 8.2K 
[TXT]school-info-Indian-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-Outreach..>2020-01-19 17:26 8.2K 
[TXT]school-info-Padmavat..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mary-Imm..>2020-01-19 17:26 8.2K 
[TXT]school-info-Holy-Cre..>2020-01-19 17:26 8.2K 
[TXT]school-info-Narmada-..>2020-01-19 17:26 8.2K 
[TXT]school-info-LR-Cambr..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hombegow..>2020-01-19 17:26 8.2K 
[TXT]school-info-Eshwari-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smt--Gan..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Gar..>2020-01-19 17:26 8.2K 
[TXT]school-info-K-J-Nurs..>2020-01-19 17:26 8.2K 
[TXT]school-info-Bharati-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Global-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Patel-Pr..>2020-01-19 17:26 8.2K 
[TXT]school-info-Indo-Asi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Patel-Pu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Seshadri..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shree-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Governme..>2020-01-19 17:26 8.2K 
[TXT]school-info-Holy-Spi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Maruthi-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Maruthi-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Maruthi-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Maruthi-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Miranda-..>2020-01-19 17:26 8.2K 
[TXT]school-info-St-Vince..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kenmore-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cambridg..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vivekana..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Char..>2020-01-19 17:26 8.2K 
[TXT]school-info-Godwin-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Red-Soil..>2020-01-19 17:26 8.2K 
[TXT]school-info-Californ..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shri-Vid..>2020-01-19 17:26 8.2K 
[TXT]school-info-SJES-Edu..>2020-01-19 17:26 8.2K 
[TXT]school-info-Indo-Ger..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jeeyar-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Poornapr..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Mark..>2020-01-19 17:26 8.2K 
[TXT]school-info-Puul's-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Eben-Eze..>2020-01-19 17:26 8.2K 
[TXT]school-info-Liarence..>2020-01-19 17:26 8.2K 
[TXT]school-info-Play-Wel..>2020-01-19 17:26 8.2K 
[TXT]school-info-Noble-Sa..>2020-01-19 17:26 8.2K 
[TXT]school-info-Madarasa..>2020-01-19 17:26 8.2K 
[TXT]school-info-Twinkle-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Huda-Nat..>2020-01-19 17:26 8.2K 
[TXT]school-info-Huda-Nat..>2020-01-19 17:26 8.2K 
[TXT]school-info-Conrad-H..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nalapad-..>2020-01-19 17:26 8.2K 
[TXT]school-info-ABHYAS-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-Holy-Sai..>2020-01-19 17:26 8.2K 
[TXT]school-info-Advaya-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tiny-Hom..>2020-01-19 17:26 8.2K 
[TXT]school-info-Greenfie..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nanhe-Ka..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smrti-Ac..>2020-01-19 17:26 8.2K 
[TXT]school-info-Buddhi-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shibumi-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ohana-Ke..>2020-01-19 17:26 8.2K 
[TXT]school-info-Centre-f..>2020-01-19 17:26 8.2K 
[TXT]school-info-Creative..>2020-01-19 17:26 8.2K 
[TXT]school-info-Abheek-–..>2020-01-19 17:26 8.2K 
[TXT]school-info-BeMe-Kag..>2020-01-19 17:26 8.2K 
[TXT]school-info-Nurture-..>2020-01-19 17:26 8.2K 
[TXT]school-info-R-V-Publ..>2020-01-19 17:26 8.2K 
[TXT]school-info-Trotters..>2020-01-19 17:26 8.2K 
[TXT]school-info-Growing-..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Gran..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Cas..>2020-01-19 17:26 8.2K 
[TXT]school-info-Smartkid..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-U..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee D..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kumon-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-HDFC..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vedic-Ma..>2020-01-19 17:26 8.2K 
[TXT]school-info-BETHANY-..>2020-01-19 17:26 8.2K 
[TXT]school-info-BETHANY-..>2020-01-19 17:26 8.2K 
[TXT]school-info-BETHANY-..>2020-01-19 17:26 8.2K 
[TXT]school-info-BETHANY-..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-HDFC..>2020-01-19 17:26 8.2K 
[TXT]school-info-Oneira-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Jai-Lear..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kids-Car..>2020-01-19 17:26 8.2K 
[TXT]school-info-Red-Cher..>2020-01-19 17:26 8.2K 
[TXT]school-info-Christ-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hayagriv..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ekya-Sch..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Mont..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Mont..>2020-01-19 17:26 8.2K 
[TXT]school-info-Madhuban..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cherubs-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Cherubs-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzenia..>2020-01-19 17:26 8.2K 
[TXT]school-info-Maasoom-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Butterfi..>2020-01-19 17:26 8.2K 
[TXT]school-info-Wise-Int..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mount-Li..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kidzee-K..>2020-01-19 17:26 8.2K 
[TXT]school-info-Shakunta..>2020-01-19 17:26 8.2K 
[TXT]school-info-Butterfl..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sacchari..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hello-Ki..>2020-01-19 17:26 8.2K 
[TXT]school-info-Kaveri-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-Early-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-Early-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-Early-In..>2020-01-19 17:26 8.2K 
[TXT]school-info-CDC-kids..>2020-01-19 17:26 8.2K 
[TXT]school-info-ELITE-KI..>2020-01-19 17:26 8.2K 
[TXT]school-info-Ayelet-M..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sanfort-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sanfort-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Robbia-P..>2020-01-19 17:26 8.2K 
[TXT]school-info-Tiny-Kin..>2020-01-19 17:26 8.2K 
[TXT]school-info-Mothers-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Baby-Mon..>2020-01-19 17:26 8.2K 
[TXT]school-info-Canaan-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-Hikmah-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-Carmel-G..>2020-01-19 17:26 8.2K 
[TXT]school-info-PNS-Scho..>2020-01-19 17:26 8.2K 
[TXT]school-info-S-V-Cent..>2020-01-19 17:26 8.2K 
[TXT]school-info-VIDYANJA..>2020-01-19 17:26 8.2K 
[TXT]school-info-Apollo-C..>2020-01-19 17:26 8.2K 
[TXT]school-info-ACHARYA-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Navkis-E..>2020-01-19 17:26 8.2K 
[TXT]school-info-B-M-N-PU..>2020-01-19 17:26 8.2K 
[TXT]school-info-Modern-S..>2020-01-19 17:26 8.2K 
[TXT]school-info-RV-Girls..>2020-01-19 17:26 8.2K 
[TXT]school-info-Good-She..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Para..>2020-01-19 17:26 8.2K 
[TXT]school-info-SV-Sunri..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sri-Shar..>2020-01-19 17:26 8.2K 
[TXT]school-info-Asirvana..>2020-01-19 17:26 8.2K 
[TXT]school-info-St--Jose..>2020-01-19 17:26 8.2K 
[TXT]school-info-Wisdom-I..>2020-01-19 17:26 8.2K 
[TXT]school-info-National..>2020-01-19 17:26 8.2K 
[TXT]school-info-National..>2020-01-19 17:26 8.2K 
[TXT]school-info-shishuku..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Prin..>2020-01-19 17:26 8.2K 
[TXT]school-info-HAL-Publ..>2020-01-19 17:26 8.2K 
[TXT]school-info-Navodaya..>2020-01-19 17:26 8.2K 
[TXT]school-info-The-Fran..>2020-01-19 17:26 8.2K 
[TXT]school-info-Deeksha-..>2020-01-19 17:26 8.2K 
[TXT]school-info-Maple-Be..>2020-01-19 17:26 8.2K 
[TXT]school-info-Vivekana..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-W..>2020-01-19 17:26 8.2K 
[TXT]school-info-Indo-Ame..>2020-01-19 17:26 8.2K 
[TXT]school-info-Blossoms..>2020-01-19 17:26 8.2K 
[TXT]school-info-Sharanya..>2020-01-19 17:26 8.2K 
[TXT]school-info-Timekids..>2020-01-19 17:26 8.2K 
[TXT]school-info-Little-A..>2020-01-19 17:26 8.2K 
[TXT]school-info-ABHYAS-T..>2020-01-19 17:26 8.2K 
[TXT]school-info-Edify-Sc..>2020-01-19 17:26 8.2K